Complexation of the 2,4,6-triallyloxy-1,3,5-triazine with copper(I,II) chlorides. Syntheses and crystal structures of [CuCl2 center dot 2C(3)N(3)(OC3H5)(3)], [Cu7Cl8 center dot 2C(3)N(3)(OC3H5)(3)], and [Cu8Cl8 center dot 2C(3)N(3)(OC3H5)(3)]center dot 2C(2)H(5)OH

Abstract

Interaction of copper(II) chloride with 2,4,6-triallyloxy-1,3,5-triazine leads to formation of copper(II) complex [CuCl(2)(.)2C(3)N(3)(OC3H5)(3)] (I). Electrochemical reduction of I produces the mixed-valence Cu-I,Cu-II pi,sigma-complex of [CU(7)Cl(8)(.)2C(3)N(3)(OC3H5)(3)] (II). Final reduction produces CU(8)Cl(8)(.)2C(3)N(3)(OC3H5)(3)2C(2)H(5)OH copper(l) pi-complex (III). Low-temperature X-ray structure investigation of all three compounds has been performed: I: space group P (l) over bar, a = 8.9565(6), b = 9.0114(6), c = 9.7291(7) Angstrom, alpha = 64.873(7), beta = 80.661(6), gamma = 89.131(6)degrees, V = 700.2(2) Angstrom(3), Z = 1, R = 0.0302 for 2893 reflections. II: space group P (l) over bar, a = 11.698(2), b 11.162(1), c = 8.106(1) Angstrom, alpha = 93.635(9), beta = 84.24(1), gamma = 89.395(8)degrees, V = 962.0(5) Angstrom(3), Z = 1, R = 0.0465 for 6111 reflections. III: space group P (l) over bar, a = 8.7853(9) b = 10.3602(9), c = 12.851(1) Angstrom, alpha = 99.351(8), beta = 105.516(9), gamma = 89.395(8), V = 1111.4(4) Angstrom(3), Z = 1, R = 0.0454 for 4470 reflections. Structure of I contains isolated [CuCl(2)(.)2C(3)N(3)(OC3H5)(3)] units. The isolated fragment of I fulfils in the structure of II bridging function connecting two hexagonal prismatic-like cores Cu6Cl6, whereas isolated Cu6Cl6(CuCl)(2) prismatic derivative appears in III. Coordination behaviour of the 2,4,6-triallyloxy-1,3,5-triazine moiety is different in all the compounds. In I ligand moiety binds to the only copper(II) atom through the nitrogen atom of the triazine ring. In II ligand is coordinated to the Cu-II-atom through the N atom and to two Cu-I ones through the two allylic groups. In III all allylic groups and nitrogen atom are coordinated by four metal centers. The presence of three allyl arms promotes an acting in II and III structures the bridging function of the ligand moiety. On the other hand, space separation of ally] groups enables a formation of large complicated inorganic clusters.